Sortin2 structure
|
Common Name | Sortin2 | ||
|---|---|---|---|---|
| CAS Number | 372972-39-9 | Molecular Weight | 429.918 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H12ClNO5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sortin2Sortin2 is a synthetic compound. Sortin2 can affect protein targeting to the vacuole in Saccharomyces cerevisiae[1]. |
| Name | 2-[(5E)-5-{[5-(3-Chlorophenyl)-2-furyl]methylene}-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Sortin2 is a synthetic compound. Sortin2 can affect protein targeting to the vacuole in Saccharomyces cerevisiae[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H12ClNO5S3 |
| Molecular Weight | 429.918 |
| Exact Mass | 428.956604 |
| LogP | 2.04 |
| Index of Refraction | 1.749 |
| InChIKey | CUKZYGAOTUDVNI-ZROIWOOFSA-N |
| SMILES | O=C1C(=Cc2ccc(-c3cccc(Cl)c3)o2)SC(=S)N1CCS(=O)(=O)O |
| 3-Thiazolidineethanesulfonic acid, 5-[[5-(3-chlorophenyl)-2-furanyl]methylene]-4-oxo-2-thioxo-, (5E)- |
| MFCD01955026 |
| 2-[(5E)-5-{[5-(3-Chlorophenyl)-2-furyl]methylene}-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]ethanesulfonic acid |