1-Adamantyl(hydroxy)dimethyl-.lambda.~5~-azane structure
|
Common Name | 1-Adamantyl(hydroxy)dimethyl-.lambda.~5~-azane | ||
|---|---|---|---|---|
| CAS Number | 3717-41-7 | Molecular Weight | 195.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dimethyladamantan-1-amine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21NO |
|---|---|
| Molecular Weight | 195.30100 |
| Exact Mass | 195.16200 |
| PSA | 29.43000 |
| LogP | 2.55030 |
| InChIKey | IYWIVICINGQCIS-UHFFFAOYSA-N |
| SMILES | C[N+](C)([O-])C12CC3CC(CC(C3)C1)C2 |
| HS Code | 2921300090 |
|---|
|
~57%
1-Adamantyl(hyd... CAS#:3717-41-7 |
| Literature: Lorand, John P.; Anderson, James L.; Shafer, Brian P.; Verral, Daniel L. Journal of Organic Chemistry, 1993 , vol. 58, # 6 p. 1560 - 1563 |
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-(Dimethylamino)adamantane N-oxide |
| [1]Adamantyl-dimethyl-amin-N-oxid |