(2-ethyl-1H-indol-3-yl)-pyridin-3-yl-methanone structure
|
Common Name | (2-ethyl-1H-indol-3-yl)-pyridin-3-yl-methanone | ||
|---|---|---|---|---|
| CAS Number | 37128-59-9 | Molecular Weight | 250.29500 | |
| Density | 1.214g/cm3 | Boiling Point | 500ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.4ºC | |
| Name | (2-ethyl-1H-indol-3-yl)-pyridin-3-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 500ºC at 760 mmHg |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.29500 |
| Flash Point | 252.4ºC |
| Exact Mass | 250.11100 |
| PSA | 45.75000 |
| LogP | 3.35630 |
| Index of Refraction | 1.658 |
| InChIKey | MJDDXYKHALIFSZ-UHFFFAOYSA-N |
| SMILES | CCc1[nH]c2ccccc2c1C(=O)c1cccnc1 |
|
~%
(2-ethyl-1H-ind... CAS#:37128-59-9 |
| Literature: Sengupta, Dibyendu; Khanna, J. M.; Kumar, Alok; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 1012 - 1014 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-ethyl-indol-3-yl)-pyridin-3-yl-methanone |
| 2-Ethylindol-3-yl-pyridin-3-yl-keton |
| 3-Pyridyl 3-(2-ethyl)indolyl ketone |