Adinazolamum structure
|
Common Name | Adinazolamum | ||
|---|---|---|---|---|
| CAS Number | 37115-32-5 | Molecular Weight | 351.83300 | |
| Density | 1.31g/cm3 | Boiling Point | 527ºC at 760 mmHg | |
| Molecular Formula | C19H18ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.5ºC | |
Use of AdinazolamumAdinazolam (brand name: Deracyn) is a benzodiazepine derivative, more specifically, a triazolobenzodiazepine (TBZD). It possesses anxiolytic, anticonvulsant, sedative, and antidepressant properties. Adinazolam was developed by Dr. Jackson B. Hester, who was seeking to enhance the antidepressant properties of alprazolam, which he also developed. Adinazolam was never FDA approved and was never available to the public. |
| Name | adinazolam |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 527ºC at 760 mmHg |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.83300 |
| Flash Point | 272.5ºC |
| Exact Mass | 351.12500 |
| PSA | 46.31000 |
| LogP | 2.76890 |
| Index of Refraction | 1.68 |
| InChIKey | GJSLOMWRLALDCT-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2 |
| RIDADR | UN 3249 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| Deracyn |
| 1-(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-N,N-dimethylmethanamine |
| Adinazolamum |
| C19H18ClN5 |
| ADINAZOLAM |