tibric acid
Modify Date: 2025-08-25 16:31:47
tibric acid structure
|
Common Name | tibric acid | ||
|---|---|---|---|---|
| CAS Number | 37087-94-8 | Molecular Weight | 331.82 | |
| Density | 1.331g/cm3 | Boiling Point | 488.2ºC at 760mmHg | |
| Molecular Formula | C14H18ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of tibric acidTibric acid (CP 18524) has similar effects to those of hypolipidemic agents. Tibric acid has orally active triglyceride-lowering effects. Tibric acid can be used for research of hypertriglyceridemia[1][2]. |
| Name | 2-chloro-5-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Tibric acid (CP 18524) has similar effects to those of hypolipidemic agents. Tibric acid has orally active triglyceride-lowering effects. Tibric acid can be used for research of hypertriglyceridemia[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 488.2ºC at 760mmHg |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 |
| Exact Mass | 331.06500 |
| PSA | 83.06000 |
| LogP | 3.72350 |
| Index of Refraction | 1.562 |
| InChIKey | IFXSWTIWFGIXQO-AOOOYVTPSA-N |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(Cl)c(C(=O)O)c2)C1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| EINECS 253-344-0 |
| C14H18ClNO4S |
| Tibric acid |
| 2-Chloro-5-(3,5-dimethylpiperidinosulphonyl)benzoic acid |
| Acido tibrico [INN-Spanish] |
| EINECS 246-198-4 |
| Acide tibrique [INN-French] |
| Acidum tibricum [INN-Latin] |