AURORA 18385
Modify Date: 2025-08-26 17:58:10
AURORA 18385 structure
|
Common Name | AURORA 18385 | ||
|---|---|---|---|---|
| CAS Number | 370841-36-4 | Molecular Weight | 290.31400 | |
| Density | 1.269g/cm3 | Boiling Point | 465.1ºC at 760 mmHg | |
| Molecular Formula | C15H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1ºC | |
| Name | ethyl 4-(2-hydroxyethylamino)-6-methoxyquinoline-3-carboxylate |
|---|
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760 mmHg |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.31400 |
| Flash Point | 235.1ºC |
| Exact Mass | 290.12700 |
| PSA | 80.68000 |
| LogP | 1.89730 |
| Index of Refraction | 1.627 |
| InChIKey | GGFUURYMMCWQOI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2ccc(OC)cc2c1NCCO |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |