3-(2,4-dichlorophenyl)-2-thiophen-2-yl-prop-2-enenitrile
Modify Date: 2025-09-29 18:21:20
3-(2,4-dichlorophenyl)-2-thiophen-2-yl-prop-2-enenitrile structure
|
Common Name | 3-(2,4-dichlorophenyl)-2-thiophen-2-yl-prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 37034-01-8 | Molecular Weight | 280.17200 | |
| Density | 1.405g/cm3 | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl2NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
| Name | 3-(2,4-dichlorophenyl)-2-thiophen-2-ylprop-2-enenitrile |
|---|
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760 mmHg |
| Molecular Formula | C13H7Cl2NS |
| Molecular Weight | 280.17200 |
| Flash Point | 199.9ºC |
| Exact Mass | 278.96800 |
| PSA | 52.03000 |
| LogP | 5.11908 |
| Index of Refraction | 1.676 |
| InChIKey | AFQZOFRLHFTECH-UXBLZVDNSA-N |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)c1cccs1 |
|
~%
3-(2,4-dichloro... CAS#:37034-01-8 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1952 , p. 4590,4593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |