2-Propen-1-one, 3-(dimethylamino)-2-fluoro-1-(4-methylphenyl)- (9CI) structure
|
Common Name | 2-Propen-1-one, 3-(dimethylamino)-2-fluoro-1-(4-methylphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 37032-46-5 | Molecular Weight | 207.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-3-(dimethylamino)-2-fluoro-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14FNO |
|---|---|
| Molecular Weight | 207.24400 |
| Exact Mass | 207.10600 |
| PSA | 20.31000 |
| LogP | 2.55020 |
| InChIKey | CHCFWUJWJYUVFI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(F)=CN(C)C)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-PROPEN-1-ONE,3-(DIMETHYLAMINO)-2-FLUORO-1-(4-METHYLPHENYL) |
| (1-Fluor-2-dimethylaminovinyl)-p-tolyl-keton |