1-(4-benzhydrylpiperidin-1-yl)-2,2-dimethylpropan-1-one structure
|
Common Name | 1-(4-benzhydrylpiperidin-1-yl)-2,2-dimethylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 37015-89-7 | Molecular Weight | 335.48200 | |
| Density | 1.046g/cm3 | Boiling Point | 475.5ºC at 760 mmHg | |
| Molecular Formula | C23H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.5ºC | |
| Name | 1-(4-benzhydrylpiperidin-1-yl)-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.046g/cm3 |
|---|---|
| Boiling Point | 475.5ºC at 760 mmHg |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.48200 |
| Flash Point | 192.5ºC |
| Exact Mass | 335.22500 |
| PSA | 20.31000 |
| LogP | 5.04110 |
| Index of Refraction | 1.557 |
| InChIKey | LJKZRLLHXPYRNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCC(C(c2ccccc2)c2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-benzhydryl-1-(2,2-dimethyl-propionyl)-piperidine |
| 1-[4-(diphenylmethyl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
| Piperidine,1-(2,2-dimethyl-1-oxopropyl)-4-(diphenylmethyl) |
| 1-(2,2-Dimethyl-1-oxopropyl)-4-(diphenylmethyl)piperidine |