Ethanone, 2,2,2-trifluoro-1-[3-(hydroxymethyl)phenyl]- (9CI) structure
|
Common Name | Ethanone, 2,2,2-trifluoro-1-[3-(hydroxymethyl)phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 370104-02-2 | Molecular Weight | 204.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-1-[3-(hydroxymethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3O2 |
|---|---|
| Molecular Weight | 204.14600 |
| Exact Mass | 204.04000 |
| PSA | 37.30000 |
| LogP | 1.92390 |
| InChIKey | SFXBJJDFUSXWEH-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(CO)c1)C(F)(F)F |
|
~%
Ethanone, 2,2,2... CAS#:370104-02-2 |
| Literature: Doucet-Personeni; Bentley; Fletcher; Kinkaid; Kryger; Pirard; Taylor; Viner; Silman; Sussman; Greenblatt; Lewis Journal of Medicinal Chemistry, 2001 , vol. 44, # 20 p. 3203 - 3215 |
|
~%
Ethanone, 2,2,2... CAS#:370104-02-2 |
| Literature: Doucet-Personeni; Bentley; Fletcher; Kinkaid; Kryger; Pirard; Taylor; Viner; Silman; Sussman; Greenblatt; Lewis Journal of Medicinal Chemistry, 2001 , vol. 44, # 20 p. 3203 - 3215 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-trifluoroacetylbenzyl alcohol |
| 2,2,2-TRIFLUORO-1-[3-(HYDROXYMETHYL)PHENYL]-ETHANONE |