2-[phenyl(phenyldiazenyl)methyl]propanedinitrile
Modify Date: 2025-10-21 18:53:24
![2-[phenyl(phenyldiazenyl)methyl]propanedinitrile Structure](https://image.chemsrc.com/caspic/281/3701-09-5.png)
2-[phenyl(phenyldiazenyl)methyl]propanedinitrile structure
|
Common Name | 2-[phenyl(phenyldiazenyl)methyl]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 3701-09-5 | Molecular Weight | 260.29300 | |
| Density | 1.1g/cm3 | Boiling Point | 424ºC at 760 mmHg | |
| Molecular Formula | C16H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 2-[phenyl(phenyldiazenyl)methyl]propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760 mmHg |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.29300 |
| Flash Point | 210.2ºC |
| Exact Mass | 260.10600 |
| PSA | 72.30000 |
| LogP | 4.17496 |
| Index of Refraction | 1.603 |
| InChIKey | RROCVGOQYPOLIO-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)C(N=Nc1ccccc1)c1ccccc1 |
| HS Code | 2927000090 |
|---|
|
~%
2-[phenyl(pheny... CAS#:3701-09-5 |
| Literature: Curtin; Russell Journal of the American Chemical Society, 1951 , vol. 73, p. 4975 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Phenyl-azo-benzyl-malonitril |
| benzyl-phenylazo-malononitrile |
| F 2295 |
| Phenyl-azo-benzyl-malonitril [German] |
| MALONONITRILE,BENZYL(PHENYLAZO) |