NSC 80538 structure
|
Common Name | NSC 80538 | ||
|---|---|---|---|---|
| CAS Number | 370-26-3 | Molecular Weight | 280.74800 | |
| Density | 1.448g/cm3 | Boiling Point | 373.5ºC at 760 mmHg | |
| Molecular Formula | C13H10ClFN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.7ºC | |
Use of NSC 80538NSC 80538 is a bioactive compound. |
| Name | 1-(4-chlorophenyl)-3-(4-fluorophenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 373.5ºC at 760 mmHg |
| Molecular Formula | C13H10ClFN2S |
| Molecular Weight | 280.74800 |
| Flash Point | 179.7ºC |
| Exact Mass | 280.02400 |
| PSA | 56.15000 |
| LogP | 4.43400 |
| Index of Refraction | 1.727 |
| InChIKey | NIPYHMPCDVJZQR-UHFFFAOYSA-N |
| SMILES | Fc1ccc(NC(=S)Nc2ccc(Cl)cc2)cc1 |
| Storage condition | -20℃ |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| NSC 80538 |