3-Methyl-6-phenyl-1,2,4-triazin-5-ol
Modify Date: 2025-08-25 10:45:44
3-Methyl-6-phenyl-1,2,4-triazin-5-ol structure
|
Common Name | 3-Methyl-6-phenyl-1,2,4-triazin-5-ol | ||
|---|---|---|---|---|
| CAS Number | 36993-94-9 | Molecular Weight | 187.19800 | |
| Density | 1.27g/cm3 | Boiling Point | 296.3ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133ºC | |
| Name | metamitron-desamino |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 296.3ºC at 760 mmHg |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.19800 |
| Flash Point | 133ºC |
| Exact Mass | 187.07500 |
| PSA | 58.90000 |
| LogP | 1.55260 |
| Index of Refraction | 1.645 |
| InChIKey | OUSYWCQYMPDAEO-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccccc2)c(=O)[nH]1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 3-methyl-6-phenyl-1,2,4-triazin-5-one |
| deaminometamitron |
| 3-methyl-6-phenyl-1,2,4-triazin-5(4H)-one |
| desaminometamitron |
| 3-Methyl-6-phenyl-1,2,4-triazin-5-on |
| F1285-0655 |
| 3-methyl-6-phenyl-2H-1,2,4-triazin-5-one |
| 3-methyl-6-phenyl-4H-1,2,4-triazin-5-one |