3-heptyl-2-methyl-1H-quinolin-4-one
Modify Date: 2025-08-26 12:57:25
3-heptyl-2-methyl-1H-quinolin-4-one structure
|
Common Name | 3-heptyl-2-methyl-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 36970-34-0 | Molecular Weight | 257.37100 | |
| Density | 0.996g/cm3 | Boiling Point | 372.5ºC at 760 mmHg | |
| Molecular Formula | C17H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.2ºC | |
| Name | 2-methyl-2,3-epoxydecane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.996g/cm3 |
|---|---|
| Boiling Point | 372.5ºC at 760 mmHg |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.37100 |
| Flash Point | 123.2ºC |
| Exact Mass | 257.17800 |
| PSA | 32.86000 |
| LogP | 4.34940 |
| Index of Refraction | 1.521 |
| InChIKey | HJFZIOAIPXNRBX-UHFFFAOYSA-N |
| SMILES | CCCCCCCc1c(C)[nH]c2ccccc2c1=O |
|
~70%
3-heptyl-2-meth... CAS#:36970-34-0 |
| Literature: Cross, R. Matthew; Monastyrskyi, Andrii; Mutka, Tina S.; Burrows, Jeremy N.; Kyle, Dennis E.; Manetsch, Roman Journal of Medicinal Chemistry, 2010 , vol. 53, # 19 p. 7076 - 7094 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Oxirane,3-heptyl-2,2-dimethyl |
| 2-Methyl-3-n-heptyl-4(1H)-chinolon |
| 3-heptyl-2,2-dimethyl-oxirane |
| 3-heptyl-2-methylquinolin-4(1H)-one |
| 3-heptyl-2-methyl-4(1H)-quinolone |
| 3-heptyl-2-methyl-1H-quinolin-4-one |