N,N-diethyl-2-(1-methyl-5-nitrobenzimidazol-2-yl)sulfanylethanamine structure
|
Common Name | N,N-diethyl-2-(1-methyl-5-nitrobenzimidazol-2-yl)sulfanylethanamine | ||
|---|---|---|---|---|
| CAS Number | 36911-73-6 | Molecular Weight | 308.39900 | |
| Density | 1.26g/cm3 | Boiling Point | 466.2ºC at 760 mmHg | |
| Molecular Formula | C14H20N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | N,N-diethyl-2-(1-methyl-5-nitrobenzimidazol-2-yl)sulfanylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760 mmHg |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.39900 |
| Flash Point | 235.7ºC |
| Exact Mass | 308.13100 |
| PSA | 92.18000 |
| LogP | 3.43860 |
| Index of Refraction | 1.619 |
| InChIKey | PEORAXVROSWSJM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCSc1nc2cc([N+](=O)[O-])ccc2n1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-diethyl-2-[(1-methyl-5-nitro-1H-benzimidazol-2-yl)sulfanyl]ethanamine |
| BENZIMIDAZOLE,2-(2-(DIETHYLAMINO)ETHYLTHIO)-1-METHYL-5-NITRO |
| diethyl-[2-(1-methyl-5-nitro-1H-benzoimidazol-2-ylsulfanyl)-ethyl]-amine |