2-Methyl-2-(1-pyrrolidinyl)-N-phenylpropionamide
Modify Date: 2025-09-22 12:55:19
2-Methyl-2-(1-pyrrolidinyl)-N-phenylpropionamide structure
|
Common Name | 2-Methyl-2-(1-pyrrolidinyl)-N-phenylpropionamide | ||
|---|---|---|---|---|
| CAS Number | 3690-18-4 | Molecular Weight | 232.32100 | |
| Density | 1.109g/cm3 | Boiling Point | 413.3ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | N-phenyl-3-pyrrolidin-1-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 413.3ºC at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 203.7ºC |
| Exact Mass | 232.15800 |
| PSA | 35.83000 |
| LogP | 3.08690 |
| Index of Refraction | 1.58 |
| InChIKey | IYKDWKLABAJFHA-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)Nc1ccccc1)N1CCCC1 |
| HS Code | 2933990090 |
|---|
|
~%
2-Methyl-2-(1-p... CAS#:3690-18-4 |
| Literature: Wilder Smith Helvetica Chimica Acta, 1959 , vol. 42, p. 1764,1768, 1770 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Anilide de l'acide (pyrrolidino-N)-3-n-butyrique [French] |
| 3-Pyrrolidino-buttersaeure-anilid |
| 3-pyrrolidino-butyric acid anilide |
| Anilide of (pyrrolidino-N)-3-N-butyric acid |
| WS-10 |
| 3-Pyrrolidinylbutyranilide |