3,5-difluorotyrosine structure
|
Common Name | 3,5-difluorotyrosine | ||
|---|---|---|---|---|
| CAS Number | 369-96-0 | Molecular Weight | 217.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9F2NO3 |
|---|---|
| Molecular Weight | 217.16900 |
| Exact Mass | 217.05500 |
| PSA | 83.55000 |
| LogP | 1.32510 |
| InChIKey | KPKMCRFCNWVLDA-UHFFFAOYSA-N |
| SMILES | NC(Cc1cc(F)c(O)c(F)c1)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Tyrosine,3,5-difluoro |
| 3,5-Difluoro-DL-tyrosine |
| 3,5-Difluorotyrosine |