naphthol as-lt
Modify Date: 2025-08-25 19:05:07
naphthol as-lt structure
|
Common Name | naphthol as-lt | ||
|---|---|---|---|---|
| CAS Number | 3689-20-1 | Molecular Weight | 307.34300 | |
| Density | 1.274 g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C19H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | naphthol as-lt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274 g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.34300 |
| Flash Point | 218ºC |
| Exact Mass | 307.12100 |
| PSA | 58.56000 |
| LogP | 4.18770 |
| Index of Refraction | 1.688 |
| InChIKey | BPLTYDPIHLNUAR-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2cc3ccccc3cc2O)c(C)c1 |
| HS Code | 2924299090 |
|---|
|
~%
naphthol as-lt CAS#:3689-20-1 |
| Literature: Ueno; Suzuki Kogyo Kagaku Zasshi, 1934 , vol. 37, p. 514,516 J.Soc.chem.Ind.Japan Spl., 1934 , vol. 37, p. 233 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Azoic CC 24 |
| Naphtol AS-LT. |
| 3-hydroxy-2'-methyl-2-naphth-p-anisidide |
| C.I.Azoic Coupling Component 24 |
| 3-hydroxy-4'-methoxy-2'-methyl-2-naphthanilide |
| 3-hydroxy-naphthalene-2-carboxylic acid 4-methoxy-2-methyl-anilide |