1,6-dinitrophenazine
Modify Date: 2025-09-20 16:26:37
1,6-dinitrophenazine structure
|
Common Name | 1,6-dinitrophenazine | ||
|---|---|---|---|---|
| CAS Number | 36848-41-6 | Molecular Weight | 270.20000 | |
| Density | 1.61g/cm3 | Boiling Point | 510.6ºC at 760mmHg | |
| Molecular Formula | C12H6N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.6ºC | |
| Name | 1,6-dinitrophenazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 510.6ºC at 760mmHg |
| Molecular Formula | C12H6N4O4 |
| Molecular Weight | 270.20000 |
| Flash Point | 262.6ºC |
| Exact Mass | 270.03900 |
| PSA | 117.42000 |
| LogP | 3.64580 |
| Index of Refraction | 1.792 |
| InChIKey | BZGCNHUWISZVPK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2nc3c([N+](=O)[O-])cccc3nc12 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:16582-03-9
CAS#:658052-27-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BZGCNHUWISZVPK-UHFFFAOYSA |
| Phenazine,1,6-dinitro |
| 1,6-Dinitrophenazin |
| 1,6-dinitro-phenazine |