N-(3-Indolylacetyl)-L-leucine structure
|
Common Name | N-(3-Indolylacetyl)-L-leucine | ||
|---|---|---|---|---|
| CAS Number | 36838-63-8 | Molecular Weight | 288.342 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 591.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H20N2O3 | Melting Point | 198-200ºC(lit.) | |
| MSDS | N/A | Flash Point | 311.4±27.3 °C | |
| Name | N-(3-Indolylacetyl)-L-leucine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.4±40.0 °C at 760 mmHg |
| Melting Point | 198-200ºC(lit.) |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.342 |
| Flash Point | 311.4±27.3 °C |
| Exact Mass | 288.147400 |
| PSA | 82.19000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | HCZNPUHZYPPINM-AWEZNQCLSA-N |
| SMILES | CC(C)CC(NC(=O)Cc1c[nH]c2ccccc12)C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2933990090 |
|
~%
N-(3-Indolylace... CAS#:36838-63-8 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 591, p. 192,198 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(1H-Indol-3-ylacetyl)-D-leucine |
| INDOLE-3-ACETYL-L-LEUCINE |
| IAA-L-LEU |
| 5-hydroxy-6-methylnicotinic acid |
| D-Leucine, N-[2-(1H-indol-3-yl)acetyl]- |
| N-indol-3-ylacetyl-leucine |