2-chlorophenothiazine-10-carbonyl chloride
Modify Date: 2025-10-31 12:08:16
2-chlorophenothiazine-10-carbonyl chloride structure
|
Common Name | 2-chlorophenothiazine-10-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 36798-98-8 | Molecular Weight | 296.17200 | |
| Density | 1.521g/cm3 | Boiling Point | 459.1ºC at 760mmHg | |
| Molecular Formula | C13H7Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
| Name | 2-chlorophenothiazine-10-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760mmHg |
| Molecular Formula | C13H7Cl2NOS |
| Molecular Weight | 296.17200 |
| Flash Point | 231.5ºC |
| Exact Mass | 294.96300 |
| PSA | 45.61000 |
| LogP | 5.36650 |
| Index of Refraction | 1.699 |
| InChIKey | WIUVDRZGTJXTCE-UHFFFAOYSA-N |
| SMILES | O=C(Cl)N1c2ccccc2Sc2ccc(Cl)cc21 |
| HS Code | 2934300000 |
|---|
|
~%
2-chlorophenoth... CAS#:36798-98-8 |
| Literature: BASF Patent: DE1011887 , 1955 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:50-53-3| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlor-10-chlorcarbonylphenothiazin |
| 2-Chloro-10H-phenothiazine-10-carbonyl chloride |
| Phenothiazine-10-carbonylchloride,2-chloro-(6CI,7CI,8CI) |
| EINECS 253-220-6 |
| 2-chloro-phenothiazine-10-carbonyl chloride |
| 10H-Phenothiazine-10-carbonylchloride,2-chloro |
| 2-chloro-10-chlorocarbonyl-10H-phenothiazine |
| 2-Chlorphenothiazin-10-carbonylchlorid |
| 2-Chloro-10-chlorocarbonylphenothiazine |