Floctafenic Acid
Modify Date: 2025-09-06 18:38:06
Floctafenic Acid structure
|
Common Name | Floctafenic Acid | ||
|---|---|---|---|---|
| CAS Number | 36783-34-3 | Molecular Weight | 332.27700 | |
| Density | 1.451g/cm3 | Boiling Point | 461.1ºC at 760mmHg | |
| Molecular Formula | C17H11F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.7ºC | |
| Name | Floctafenic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 461.1ºC at 760mmHg |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.27700 |
| Flash Point | 232.7ºC |
| Exact Mass | 332.07700 |
| PSA | 62.22000 |
| LogP | 4.76840 |
| Index of Refraction | 1.649 |
| InChIKey | RGUIKQRAZCQMBM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1ccnc2c(C(F)(F)F)cccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[[8-(trifluoromethyl)quinolin-4-yl]amino]benzoic acid |