3-Isothiazolecarbonylchloride,5-nitro-(9CI) structure
|
Common Name | 3-Isothiazolecarbonylchloride,5-nitro-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 36778-14-0 | Molecular Weight | 192.58000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4HClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitro-1,2-thiazole-3-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4HClN2O3S |
|---|---|
| Molecular Weight | 192.58000 |
| Exact Mass | 191.94000 |
| PSA | 104.02000 |
| LogP | 1.95350 |
| InChIKey | YJGSZFRAEXHMJU-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])sn1 |
| HS Code | 2934999090 |
|---|
|
~%
3-Isothiazoleca... CAS#:36778-14-0 |
| Literature: Walsh,R.J.A.; Wooldridge,K.R.H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1247 - 1249 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Isothiazolecarbonylchloride,5-nitro |
| 5-nitro-isothiazole-3-carbonyl chloride |
| 3-Isothiazolecarbonylchloride,5-nitro-(9CI) |
| 5-Nitroisothiazol-3-carbonsaeurechlorid |