2-(4-hydroxy-3,5-dimethyl-phenyl)indene-1,3-dione structure
|
Common Name | 2-(4-hydroxy-3,5-dimethyl-phenyl)indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 36749-59-4 | Molecular Weight | 266.29100 | |
| Density | 1.288g/cm3 | Boiling Point | 474.7ºC at 760 mmHg | |
| Molecular Formula | C17H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255ºC | |
| Name | 2-(4-hydroxy-3,5-dimethylphenyl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 474.7ºC at 760 mmHg |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.29100 |
| Flash Point | 255ºC |
| Exact Mass | 266.09400 |
| PSA | 54.37000 |
| LogP | 3.17180 |
| Index of Refraction | 1.642 |
| InChIKey | FKDQFSZBPQJDOU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C2C(=O)c3ccccc3C2=O)cc(C)c1O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-(4'-Hydroxy-3',5'-dimethylphenyl)-1,3-indandion |
| 2-(4-Hydroxy-3,5-dimethylphenyl)-1H-indene-1,3(2H)-dione |
| 2-(4-hydroxy-3,5-dimethyl-phenyl)indene-1,3-dione |