7-(4-chlorophenyl)-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 7-(4-chlorophenyl)-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 36748-65-9 | Molecular Weight | 290.70500 | |
| Density | 1.48g/cm3 | Boiling Point | 485ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.1ºC | |
| Name | 7-(4-chlorophenyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 485ºC at 760 mmHg |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.70500 |
| Flash Point | 247.1ºC |
| Exact Mass | 290.05700 |
| PSA | 61.82000 |
| LogP | 1.07630 |
| Index of Refraction | 1.7 |
| InChIKey | XYPIWKDJAGSOLC-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2-c2ccc(Cl)cc2)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-(4-Clorofenil)teofillina |
| 7-(4-Chlorphenyl)-theophyllin |
| 3,7-Dihydro-7-(4-chlorophenyl)-1,3-dimethyl-1H-purine-2,6-dione |
| 7-p-Chlorphenyltheophyllin |
| 1H-Purine-2,6-dione,3,7-dihydro-7-(4-chlorophenyl)-1,3-dimethyl |
| Theophylline,7-(p-chlorophenyl) |
| 7-(4-Clorofenil)teofillina [Italian] |
| 7-(4-chloro-phenyl)-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 7-(4-chlorophenyl)-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione |