2,5-Pyrrolidinedione,1-(5,6-dihydro-2-methoxy-4,4-dioxido-1,4,3-oxathiazin-6-yl)- structure
|
Common Name | 2,5-Pyrrolidinedione,1-(5,6-dihydro-2-methoxy-4,4-dioxido-1,4,3-oxathiazin-6-yl)- | ||
|---|---|---|---|---|
| CAS Number | 36743-55-2 | Molecular Weight | 262.24000 | |
| Density | 1.78g/cm3 | Boiling Point | 456ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.6ºC | |
| Name | 1-(2-methoxy-4,4-dioxo-5,6-dihydro-1,4,3-oxathiazin-6-yl)pyrrolidine-2,5-dione |
|---|
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 456ºC at 760 mmHg |
| Molecular Formula | C8H10N2O6S |
| Molecular Weight | 262.24000 |
| Flash Point | 229.6ºC |
| Exact Mass | 262.02600 |
| PSA | 110.72000 |
| Index of Refraction | 1.677 |
| InChIKey | ITGUWIAAVZIMJL-UHFFFAOYSA-N |
| SMILES | COC1=NS(=O)(=O)CC(N2C(=O)CCC2=O)O1 |
|
~%
2,5-Pyrrolidine... CAS#:36743-55-2 |
| Literature: Burgess,E.M.; Williams,W.M. Journal of the American Chemical Society, 1972 , vol. 94, # 12 p. 4386 - 4387 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |