methyl 3-(4-methoxyphenyl)-1,1-dioxo-thiazetidine-2-carboxylate
Modify Date: 2025-09-21 11:44:18
methyl 3-(4-methoxyphenyl)-1,1-dioxo-thiazetidine-2-carboxylate structure
|
Common Name | methyl 3-(4-methoxyphenyl)-1,1-dioxo-thiazetidine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36743-48-3 | Molecular Weight | 271.29000 | |
| Density | 1.395g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C11H13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | methyl 3-(4-methoxyphenyl)-1,1-dioxothiazetidine-2-carboxylate |
|---|
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29000 |
| Flash Point | 203.5ºC |
| Exact Mass | 271.05100 |
| PSA | 81.29000 |
| LogP | 2.16680 |
| Index of Refraction | 1.573 |
| InChIKey | OAEDOYLOMBZVEK-UHFFFAOYSA-N |
| SMILES | COC(=O)N1C(c2ccc(OC)cc2)CS1(=O)=O |
| HS Code | 2934991000 |
|---|
|
~%
methyl 3-(4-met... CAS#:36743-48-3 |
| Literature: Burgess,E.M.; Williams,W.M. Journal of the American Chemical Society, 1972 , vol. 94, # 12 p. 4386 - 4387 |
![2-methoxy-6-(4-methoxy-phenyl)-5,6-dihydro-[1,4,3]oxathiazine 4,4-dioxide structure](https://image.chemsrc.com/caspic/214/36743-49-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934991000 |
|---|---|
| Summary | 2934991000. sultones and sultams. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |