3-phenyl-2-(pyridine-3-carbonylamino)propanoic acid structure
|
Common Name | 3-phenyl-2-(pyridine-3-carbonylamino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 36724-78-4 | Molecular Weight | 270.28300 | |
| Density | 1.276g/cm3 | Boiling Point | 561.3ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.3ºC | |
| Name | 3-phenyl-2-(pyridine-3-carbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 561.3ºC at 760 mmHg |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Flash Point | 293.3ºC |
| Exact Mass | 270.10000 |
| PSA | 79.29000 |
| LogP | 1.89820 |
| Index of Refraction | 1.608 |
| InChIKey | KSZPRUJKMRILRZ-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (S)-2-(nicotinamido)-3-phenylpropanoic acid |
| N-Nicotinoyl-L-phenylalanin |
| N-nicotinoyl-L-phenylalanine |
| L-2-Nicotinoylamino-3-phenyl-propionsaeure |
| 3-phenyl-2-(pyridin-3-ylformamido)propanoic acid |