8-chloro-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole 2-oxide structure
|
Common Name | 8-chloro-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 36720-88-4 | Molecular Weight | 315.73400 | |
| Density | 1.37g/cm3 | Boiling Point | 578.5ºC at 760 mmHg | |
| Molecular Formula | C17H15ClNOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.7ºC | |
| Name | 8-chloro-2-phenyl-1,3,4,5-tetrahydrophosphinino[4,3-b]indole 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 578.5ºC at 760 mmHg |
| Molecular Formula | C17H15ClNOP |
| Molecular Weight | 315.73400 |
| Flash Point | 303.7ºC |
| Exact Mass | 315.05800 |
| PSA | 42.67000 |
| LogP | 4.56600 |
| Index of Refraction | 1.672 |
| InChIKey | NCICHKYIOOAHNX-UHFFFAOYSA-N |
| SMILES | O=P1(c2ccccc2)CCc2[nH]c3ccc(Cl)cc3c2C1 |
|
~%
8-chloro-2-phen... CAS#:36720-88-4 |
| Literature: Srivastava,K.C.; Berlin,K.D. Journal of Organic Chemistry, 1972 , vol. 37, p. 4487 - 4489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-chloro-2-phenyl-2,3,4,5-tetrahydro-1H-phosphinino[4,3-b]indole 2-oxide |