6-tert-butyl-2-(trifluoromethyl)-1H-benzimidazole
Modify Date: 2025-11-24 09:43:35
6-tert-butyl-2-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 6-tert-butyl-2-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 3671-67-8 | Molecular Weight | 242.24000 | |
| Density | 1.24g/cm3 | Boiling Point | 309.1ºC at 760 mmHg | |
| Molecular Formula | C12H13F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.7ºC | |
| Name | 6-tert-butyl-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 309.1ºC at 760 mmHg |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24000 |
| Flash Point | 140.7ºC |
| Exact Mass | 242.10300 |
| PSA | 28.68000 |
| LogP | 3.87920 |
| Index of Refraction | 1.526 |
| InChIKey | AOWYBSYMYIAJEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2nc(C(F)(F)F)[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-tert-Butyl-2-(trifluoromethyl)benzimidazole |
| BENZIMIDAZOLE,5-tert-BUTYL-2-(TRIFLUOROMETHYL) |