[2-methoxy-4-(3-oxobutyl)phenyl] acetate structure
|
Common Name | [2-methoxy-4-(3-oxobutyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 36700-46-6 | Molecular Weight | 236.26400 | |
| Density | 1.103g/cm3 | Boiling Point | 322.1ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139ºC | |
| Name | [2-methoxy-4-(3-oxobutyl)phenyl] acetate |
|---|
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 322.1ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 139ºC |
| Exact Mass | 236.10500 |
| PSA | 52.60000 |
| LogP | 2.14210 |
| Index of Refraction | 1.501 |
| InChIKey | WZACUTBSCIVUCF-UHFFFAOYSA-N |
| SMILES | COc1cc(CCC(C)=O)ccc1OC(C)=O |
|
~%
[2-methoxy-4-(3... CAS#:36700-46-6 |
| Literature: Nomura Journal of the Chemical Society, 1917 , vol. 111, p. 771 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |