3-hydroxy-3-trifluoromethyl-1,5-pentanedicarboxylic acid structure
|
Common Name | 3-hydroxy-3-trifluoromethyl-1,5-pentanedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 36610-31-8 | Molecular Weight | 216.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7F3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-3-trifluoromethyl-1,5-pentanedicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7F3O5 |
|---|---|
| Molecular Weight | 216.11200 |
| Exact Mass | 216.02500 |
| PSA | 94.83000 |
| LogP | 0.22920 |
| InChIKey | VSHSKEOCTHHYEL-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(F)(F)F |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-hydroxy-3-trifluoromethylglutaric acid |
| 3-Hydroxy-3-trifluormethyl-glutarsaeure |