5-(4-Methoxyphenyl)-3,5-dioxovaleric acid
Modify Date: 2025-10-07 17:12:25
5-(4-Methoxyphenyl)-3,5-dioxovaleric acid structure
|
Common Name | 5-(4-Methoxyphenyl)-3,5-dioxovaleric acid | ||
|---|---|---|---|---|
| CAS Number | 36568-15-7 | Molecular Weight | 236.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-methoxyphenyl)-3,5-dioxopentanoic acid |
|---|
| Molecular Formula | C12H12O5 |
|---|---|
| Molecular Weight | 236.22100 |
| Exact Mass | 236.06800 |
| PSA | 80.67000 |
| LogP | 1.31180 |
| InChIKey | FMBVOMQOZSWXLP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC(=O)CC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |