3,5-Dioxo-5-phenylvaleric acid methyl ester structure
|
Common Name | 3,5-Dioxo-5-phenylvaleric acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 36568-12-4 | Molecular Weight | 220.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,5-dioxo-5-phenylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O4 |
|---|---|
| Molecular Weight | 220.22100 |
| Exact Mass | 220.07400 |
| PSA | 60.44000 |
| LogP | 1.39160 |
| InChIKey | JENTWHKZLXBMNF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)CC(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| methyl benzoylacetoacetate |
| methyl 5-phenyl-3,5-dioxopentanoate |