1H-Pyrazole-3,5-diamine,4-(2-phenyldiazenyl)- structure
|
Common Name | 1H-Pyrazole-3,5-diamine,4-(2-phenyldiazenyl)- | ||
|---|---|---|---|---|
| CAS Number | 3656-02-8 | Molecular Weight | 202.21600 | |
| Density | 1.52g/cm3 | Boiling Point | 384.3ºC at 760mmHg | |
| Molecular Formula | C9H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.2ºC | |
| Name | 4-(phenylhydrazinylidene)pyrazole-3,5-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 384.3ºC at 760mmHg |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.21600 |
| Flash Point | 186.2ºC |
| Exact Mass | 202.09700 |
| PSA | 105.44000 |
| LogP | 3.15190 |
| Index of Refraction | 1.765 |
| InChIKey | BLXRKDXUWQFGAW-UHFFFAOYSA-N |
| SMILES | Nc1n[nH]c(N)c1N=Nc1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(phenylazo)pyrazole-3,5-diamine |
| 4-[(E)-Phenyldiazenyl]-1H-pyrazole-3,5-diamine |
| 3,5-diamino-4H-pyrazol-4-one phenylhydrazone |
| 3,5-Diamino-4-phenylazopyrazol |
| 4-phenylazo-3,5-diaminopyrazole |
| 3,5-diamino-4-phenylazopyrazole |
| 4-phenylazo-1H-pyrazole-3,5-diamine |
| 4-phenylazo-3,5-pyrazolediamine |