2-(2,4-difluorophenyl)-4-fluoro-1,3,2-benzodioxaborole structure
|
Common Name | 2-(2,4-difluorophenyl)-4-fluoro-1,3,2-benzodioxaborole | ||
|---|---|---|---|---|
| CAS Number | 365458-32-8 | Molecular Weight | 249.98100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6BF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4-difluorophenyl)-4-fluoro-1,3,2-benzodioxaborole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H6BF3O2 |
|---|---|
| Molecular Weight | 249.98100 |
| Exact Mass | 250.04100 |
| PSA | 18.46000 |
| LogP | 2.27050 |
| InChIKey | FBNMOGYJGJRGGO-UHFFFAOYSA-N |
| SMILES | Fc1ccc(B2Oc3cccc(F)c3O2)c(F)c1 |
|
~97%
2-(2,4-difluoro... CAS#:365458-32-8 |
| Literature: Lee; Ma; Yang; Sun; McBreen Journal of the Electrochemical Society, 2004 , vol. 151, # 9 p. A1429-A1435 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,2-Benzodioxaborole,2-(2,4-difluorophenyl)-4-fluoro |