Guaiacin structure
|
Common Name | Guaiacin | ||
|---|---|---|---|---|
| CAS Number | 36531-08-5 | Molecular Weight | 328.402 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 484.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.8±28.7 °C | |
Use of GuaiacinGuaiacin is a arylnaphthalene type lignin isolated from the barks of Machilus thunbergii SIEB. et ZUCC (Lauraceae). Guaiacin significantly increases alkaline phosphatase activity and osteoblast differentiation[1]. |
| Name | 2-Naphthalenol, 5,6,7,8-tetrahydro-8-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-, (6R,7S,8S) |
|---|---|
| Synonym | More Synonyms |
| Description | Guaiacin is a arylnaphthalene type lignin isolated from the barks of Machilus thunbergii SIEB. et ZUCC (Lauraceae). Guaiacin significantly increases alkaline phosphatase activity and osteoblast differentiation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 484.5±45.0 °C at 760 mmHg |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.402 |
| Flash Point | 246.8±28.7 °C |
| Exact Mass | 328.167450 |
| PSA | 58.92000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | TZAAYUCUPIYQBR-JGRMJRGVSA-N |
| SMILES | COc1cc(C2c3cc(O)c(OC)cc3CC(C)C2C)ccc1O |
| 2-Naphthalenol, 5,6,7,8-tetrahydro-8-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-, (6R,7S,8S)- |
| (+)-guaiacin |
| Guaiacin |
| (6R,7S,8S)-8-(4-Hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydro-2-naphthalenol |