2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,2-methyloxirane structure
|
Common Name | 2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,2-methyloxirane | ||
|---|---|---|---|---|
| CAS Number | 36484-54-5 | Molecular Weight | 378.89000 | |
| Density | N/A | Boiling Point | 400.8ºC at 760mmHg | |
| Molecular Formula | C21H27ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | 2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol,2-methyloxirane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 400.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H27ClO4 |
| Molecular Weight | 378.89000 |
| Flash Point | 192.4ºC |
| Exact Mass | 378.16000 |
| PSA | 65.52000 |
| LogP | 4.45280 |
| InChIKey | ZAZDSNWVKSFFLI-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC1CO1.ClCC1CO1 |
| 4,4'-(1-Methylethylidene)bis(phenol),polymer with chloromethyloxirane and methyloxirane |
| Syn Fac 8105 |