2,3-Dihydro-7-methyl-1,5-benzothiazepin-4(5H)-one 1,1-dioxide structure
|
Common Name | 2,3-Dihydro-7-methyl-1,5-benzothiazepin-4(5H)-one 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 3648-94-0 | Molecular Weight | 225.26400 | |
| Density | 1.329g/cm3 | Boiling Point | 492.7ºC at 760 mmHg | |
| Molecular Formula | C10H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.8ºC | |
| Name | 7-methyl-1,1-dioxo-3,5-dihydro-2H-1λ6,5-benzothiazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 492.7ºC at 760 mmHg |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.26400 |
| Flash Point | 251.8ºC |
| Exact Mass | 225.04600 |
| PSA | 75.11000 |
| LogP | 2.27680 |
| Index of Refraction | 1.572 |
| InChIKey | GASHTLYMYMLZPZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)NC(=O)CCS2(=O)=O |
| HS Code | 2933990090 |
|---|
|
~%
2,3-Dihydro-7-m... CAS#:3648-94-0 |
| Literature: Wuensch,K.-H. et al. Chemische Berichte, 1970 , vol. 103, p. 2302 - 2307 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-methyl-1,1-dioxo-3,5-dihydro-2H-1 |
| 7-Methyl-2,3,4,5-tetrahydro-1,5-benzothiazepin-4-on-1,1-dioxyd |
| 7-Methyl-2,3,4,5-tetrahydro-1,5-benzothiazepin-4-on-1,1-dioxid |