2-Oxo-1-phenylcyclopentaneacetic acid
Modify Date: 2025-09-18 19:37:13
2-Oxo-1-phenylcyclopentaneacetic acid structure
|
Common Name | 2-Oxo-1-phenylcyclopentaneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 3645-87-2 | Molecular Weight | 218.24800 | |
| Density | 1.212g/cm3 | Boiling Point | 413.8ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | 2-(2-oxo-1-phenylcyclopentyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 413.8ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 218.2ºC |
| Exact Mass | 218.09400 |
| PSA | 54.37000 |
| LogP | 2.15210 |
| Index of Refraction | 1.562 |
| InChIKey | NRSOFNZPFPBHBU-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1(c2ccccc2)CCCC1=O |
| HS Code | 2918300090 |
|---|
|
~%
2-Oxo-1-phenylc... CAS#:3645-87-2 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Oxo-1-phenylcyclopentaneacetic acid |
| <1-Phenyl-2-oxo-cyclopentyl>-essigsaeure |
| Cyclopentaneacetic acid,2-oxo-1-phenyl |
| 2-Oxo-1-phenylcyclopentylessigsaeure |