naphthalene-1,3,6-tricarboxylic acid structure
|
Common Name | naphthalene-1,3,6-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 36439-96-0 | Molecular Weight | 260.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-1,3,6-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8O6 |
|---|---|
| Molecular Weight | 260.19900 |
| Exact Mass | 260.03200 |
| PSA | 111.90000 |
| LogP | 1.93440 |
| InChIKey | LATKICLYWYUXCN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(C(=O)O)cc(C(=O)O)cc2c1 |
|
~%
naphthalene-1,3... CAS#:36439-96-0 |
| Literature: Dozen,Y. Bulletin of the Chemical Society of Japan, 1972 , vol. 45, p. 519 - 525 |
|
~%
naphthalene-1,3... CAS#:36439-96-0 |
| Literature: Dozen,Y. Bulletin of the Chemical Society of Japan, 1972 , vol. 45, p. 519 - 525 |
|
~%
naphthalene-1,3... CAS#:36439-96-0 |
| Literature: Dozen,Y. Bulletin of the Chemical Society of Japan, 1972 , vol. 45, p. 519 - 525 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3,6-Naphthalenetricarboxylic acid |
| Naphthalin-1,3,6-tricarbonsaeure |