ascorbic acid
Modify Date: 2025-08-25 17:33:13
ascorbic acid structure
|
Common Name | ascorbic acid | ||
|---|---|---|---|---|
| CAS Number | 36431-82-0 | Molecular Weight | 566.68500 | |
| Density | N/A | Boiling Point | 550.8ºC at 760mmHg | |
| Molecular Formula | C32H42N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.7ºC | |
| Name | 1-(4-phenethylpiperazin-1-yl)-2-(1-phenylcyclohexyl)ethanone ascorbate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 550.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.68500 |
| Flash Point | 224.7ºC |
| Exact Mass | 566.29900 |
| PSA | 130.77000 |
| LogP | 3.13390 |
| InChIKey | ZVMUBEXOERROJV-MGMRMFRLSA-N |
| SMILES | O=C(CC1(c2ccccc2)CCCCC1)N1CCN(CCc2ccccc2)CC1.O=C1OC(C(O)CO)C(O)=C1O |
| Piperazine, 1-((1-phenylcyclohexyl)acetyl)-4-(2-phenylethyl)-, compd. with L-ascorbic acid |
| (R)-5-((S)-1,2-dihydroxyethyl)-3,4-dihydroxyfuran-2(5H)-one compound with 1-(4-phenethylpiperazin-1-yl)-2-(1-phenylcyclohexyl)ethanone (1:1) |