Phosphoric acid diisopropyl 5,5,5-trichloropentyl ester
Modify Date: 2025-09-01 07:05:10
Phosphoric acid diisopropyl 5,5,5-trichloropentyl ester structure
|
Common Name | Phosphoric acid diisopropyl 5,5,5-trichloropentyl ester | ||
|---|---|---|---|---|
| CAS Number | 36357-81-0 | Molecular Weight | 355.62300 | |
| Density | 1.233g/cm3 | Boiling Point | 377ºC at 760 mmHg | |
| Molecular Formula | C11H22Cl3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | dipropan-2-yl 5,5,5-trichloropentyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 377ºC at 760 mmHg |
| Molecular Formula | C11H22Cl3O4P |
| Molecular Weight | 355.62300 |
| Flash Point | 273.6ºC |
| Exact Mass | 354.03200 |
| PSA | 54.57000 |
| LogP | 5.50160 |
| Index of Refraction | 1.463 |
| InChIKey | MFWFRDQWTNEEPL-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=O)(OCCCCC(Cl)(Cl)Cl)OC(C)C |
| HS Code | 2919900090 |
|---|
|
~%
Phosphoric acid... CAS#:36357-81-0 |
| Literature: Shepeleva,E.S. et al. Doklady Chemistry, 1972 , vol. 203, p. 317 - 319 Dokl. Akad. Nauk SSSR Ser. Khim., 1972 , vol. 203, p. 856 - 859 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphoric acid,diisopropyl 5,5,5-trichloropentyl ester |
| phosphoric acid diisopropyl ester 5,5,5-trichloro-pentyl ester |
| Diisopropyl 5,5,5-trichloropentyl phosphate |
| Trichlor-n-pentylphosphonsaeuredi-iso-propylester |