2-Propen-1-one, 3-[4- (1-methylethyl)phenyl]-1-phenyl- structure
|
Common Name | 2-Propen-1-one, 3-[4- (1-methylethyl)phenyl]-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 36336-80-8 | Molecular Weight | 250.33500 | |
| Density | 1.043g/cm3 | Boiling Point | 381.7ºC at 760 mmHg | |
| Molecular Formula | C18H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.6ºC | |
| Name | 1-phenyl-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.043g/cm3 |
|---|---|
| Boiling Point | 381.7ºC at 760 mmHg |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.33500 |
| Flash Point | 164.6ºC |
| Exact Mass | 250.13600 |
| PSA | 17.07000 |
| LogP | 4.70610 |
| Index of Refraction | 1.593 |
| InChIKey | HQIRFTXJWVJMEU-JLHYYAGUSA-N |
| SMILES | CC(C)c1ccc(C=CC(=O)c2ccccc2)cc1 |
| HS Code | 2914399090 |
|---|
|
~66%
2-Propen-1-one,... CAS#:36336-80-8 |
| Literature: Jia, Hong-Peng; Dreyer, Daniel R.; Bielawski, Christopher W. Advanced Synthesis and Catalysis, 2011 , vol. 353, # 4 p. 528 - 532 |
|
~56%
2-Propen-1-one,... CAS#:36336-80-8 |
| Literature: Jia, Hong-Peng; Dreyer, Daniel R.; Bielawski, Christopher W. Advanced Synthesis and Catalysis, 2011 , vol. 353, # 4 p. 528 - 532 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 4-isopropyl-chalcone |
| 4-Isopropyl-chalkon |
| 3-[4-(1-Methylethyl)phenyl]-1-phenyl-2-propen-1-one |
| 3-(4-isopropylphenyl)-1-phenylprop-2-en-1-one |
| Cuminalacetophenon |
| Phenyl-(4-isopropyl-styryl)-keton |