5,5,6,6,7,7,8,8-octafluoro-1,3-dioxonane structure
|
Common Name | 5,5,6,6,7,7,8,8-octafluoro-1,3-dioxonane | ||
|---|---|---|---|---|
| CAS Number | 36301-47-0 | Molecular Weight | 274.10900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5,6,6,7,7,8,8-octafluoro-1,3-dioxonane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6F8O2 |
|---|---|
| Molecular Weight | 274.10900 |
| Exact Mass | 274.02400 |
| PSA | 18.46000 |
| LogP | 2.53190 |
| InChIKey | ZQIZYJSYWHWVQJ-UHFFFAOYSA-N |
| SMILES | FC1(F)COCOCC(F)(F)C(F)(F)C1(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,3-Dioxonane,5,5,6,6,7,7,8,8-octafluoro |