diethyl 2-(2-oxopropylamino)propanedioate
Modify Date: 2025-09-07 21:13:33
diethyl 2-(2-oxopropylamino)propanedioate structure
|
Common Name | diethyl 2-(2-oxopropylamino)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 36295-64-4 | Molecular Weight | 231.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-(2-oxopropylamino)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17NO5 |
|---|---|
| Molecular Weight | 231.24600 |
| Exact Mass | 231.11100 |
| PSA | 81.70000 |
| LogP | 0.05070 |
| InChIKey | GJYJZUHSWCXCTA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NCC(C)=O)C(=O)OCC |
|
~92%
diethyl 2-(2-ox... CAS#:36295-64-4 |
| Literature: Maier, Ludwig; Lea, Peter J. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 17, p. 1 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl N-methylacetamidomalonate |
| (Methyl-acetyl-amino)-malonsaeurediaethylester |
| Propanedioic acid,(acetylmethylamino)-,diethyl ester |