4-methyl-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline
Modify Date: 2025-12-01 20:51:58
![4-methyl-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline Structure](https://image.chemsrc.com/caspic/255/36236-40-5.png)
4-methyl-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline structure
|
Common Name | 4-methyl-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 36236-40-5 | Molecular Weight | 358.69000 | |
| Density | 1.291g/cm3 | Boiling Point | 457.8ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7ºC | |
| Name | 4-methyl-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 457.8ºC at 760 mmHg |
| Molecular Formula | C17H18Cl3NO |
| Molecular Weight | 358.69000 |
| Flash Point | 230.7ºC |
| Exact Mass | 357.04500 |
| PSA | 21.26000 |
| LogP | 5.99010 |
| Index of Refraction | 1.604 |
| InChIKey | IIEVZFHJZUQMHI-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(Nc2ccc(C)cc2)C(Cl)(Cl)Cl)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-methyl-n-(2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl)aniline |