(4-formylphenyl) 2-methylprop-2-enoate
Modify Date: 2025-09-26 17:51:42
(4-formylphenyl) 2-methylprop-2-enoate structure
|
Common Name | (4-formylphenyl) 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 36195-33-2 | Molecular Weight | 190.19500 | |
| Density | 1.141g/cm3 | Boiling Point | 325.6ºC at 760mmHg | |
| Molecular Formula | C11H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3ºC | |
| Name | (4-formylphenyl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 325.6ºC at 760mmHg |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.19500 |
| Flash Point | 144.3ºC |
| Exact Mass | 190.06300 |
| PSA | 43.37000 |
| LogP | 1.98060 |
| Index of Refraction | 1.551 |
| InChIKey | NBKFKDJHUNQQKY-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc(C=O)cc1 |
| HS Code | 2916140000 |
|---|
|
~90%
(4-formylphenyl... CAS#:36195-33-2 |
| Literature: Garcia-Acosta, Beatriz; Garcia, Felix; Garcia, Jose Miguel; Martinez-Menez, Ramon; Sancenon, Felix; San-Jose, Noelia; Soto, Juan Organic Letters, 2007 , vol. 9, # 13 p. 2429 - 2432 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 4-Formylphenyl methacrylate |
| 4-formylphenyl 2-methylprop-2-enoate |
| EINECS 252-906-2 |
| Methacrylsaeure-(4-formylphenyl)-ester |
| p-Methacryloxybenzaldehyd |
| 4-methacryloyloxy-benzaldehyde |
| 4-Methacryloxybenzaldehyd |
| 4-Methacryloyloxy-benzaldehyd |
| p-Formylphenyl methacrylate |