9H-Thioxanthen-9-one, 4-[(acetyloxy)methyl]-1-[[2- (diethylamino)ethyl]amino]-
Modify Date: 2025-09-13 19:45:17
![9H-Thioxanthen-9-one, 4-[(acetyloxy)methyl]-1-[[2- (diethylamino)ethyl]amino]- Structure](https://image.chemsrc.com/caspic/087/3612-72-4.png)
9H-Thioxanthen-9-one, 4-[(acetyloxy)methyl]-1-[[2- (diethylamino)ethyl]amino]- structure
|
Common Name | 9H-Thioxanthen-9-one, 4-[(acetyloxy)methyl]-1-[[2- (diethylamino)ethyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 3612-72-4 | Molecular Weight | 398.51800 | |
| Density | 1.229g/cm3 | Boiling Point | 566ºC at 760 mmHg | |
| Molecular Formula | C22H26N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.1ºC | |
| Name | [1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]methyl acetate |
|---|
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 566ºC at 760 mmHg |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.51800 |
| Flash Point | 296.1ºC |
| Exact Mass | 398.16600 |
| PSA | 86.88000 |
| LogP | 4.30450 |
| Index of Refraction | 1.624 |
| InChIKey | YBQVWCLNKFVHCN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(COC(C)=O)c2sc3ccccc3c(=O)c12 |
| HS Code | 2932999099 |
|---|
|
~62%
9H-Thioxanthen-... CAS#:3612-72-4 |
| Literature: Archer; Pica-Mattoccia; Cioli; Seyed-Mozaffari; Zayed Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 254 - 260 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |