Inotodiol structure
|
Common Name | Inotodiol | ||
|---|---|---|---|---|
| CAS Number | 35963-37-2 | Molecular Weight | 442.72 | |
| Density | 1.03g/cm3 | Boiling Point | 534.324°C at 760 mmHg | |
| Molecular Formula | C30H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.582°C | |
Use of InotodiolInotodiol (compound 3) is a lanostane-type triterpenoid compound isolated from the sclerotia of Inonotus obliquus. Inotodiol exhibits the potent anti-tumor promoting activity in the in vivo carcinogenesis test[1]. |
| Name | (3S,10S,13R,14R,17R)-17-[(2S,3R)-3-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Inotodiol (compound 3) is a lanostane-type triterpenoid compound isolated from the sclerotia of Inonotus obliquus. Inotodiol exhibits the potent anti-tumor promoting activity in the in vivo carcinogenesis test[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 534.324°C at 760 mmHg |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.72 |
| Flash Point | 215.582°C |
| Exact Mass | 442.38100 |
| PSA | 40.46000 |
| LogP | 7.44990 |
| InChIKey | KKWJCGCIAHLFNE-KFPHZHIMSA-N |
| SMILES | CC(C)=CCC(O)C(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3 |
| 3beta,22-dihydroxylanosta-8,24-dien-7-one |
| Lanosta-8,24-dien-7-one,3beta,22-dihydroxy |
| Inotodiol |